CAS 1203-96-9
:5-Methyl-1H-indazole-3-carboxylic acid hydrazide
Description:
5-Methyl-1H-indazole-3-carboxylic acid hydrazide is an organic compound characterized by its indazole structure, which features a five-membered ring containing two nitrogen atoms. This compound is a hydrazide derivative, indicating the presence of a hydrazine functional group (-NH-NH2) attached to a carboxylic acid moiety. It typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The methyl group at the 5-position of the indazole ring contributes to its hydrophobic character, influencing its overall reactivity and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many hydrazides, it may also participate in condensation reactions, forming more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c1-5-2-3-7-6(4-5)8(13-12-7)9(14)11-10/h2-4H,10H2,1H3,(H,11,14)(H,12,13)
InChI key:InChIKey=KCOFFKBBAQNASI-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=2C(NN1)=CC=C(C)C2
Synonyms:- 5-Methyl-1H-indazole-3-carboxylic acid hydrazide
- 1H-Indazole-3-carboxylic acid, 5-methyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.