CAS 1203-97-0
:5-Chloro-1H-indazole-3-carboxylic acid hydrazide
Description:
5-Chloro-1H-indazole-3-carboxylic acid hydrazide is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chloro substituent at the 5-position and a carboxylic acid hydrazide functional group at the 3-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazide functional group. It is often studied for its potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or antimicrobial agents. The compound's structure allows for various chemical modifications, which can enhance its biological properties. As with many hydrazides, it may also participate in condensation reactions, forming more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks.
Formula:C8H7ClN4O
InChI:InChI=1S/C8H7ClN4O/c9-4-1-2-6-5(3-4)7(13-12-6)8(14)11-10/h1-3H,10H2,(H,11,14)(H,12,13)
InChI key:InChIKey=XQFHKPMDVNQYJW-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=2C(NN1)=CC=C(Cl)C2
Synonyms:- 5-Chloro-1H-indazole-3-carboxylic acid hydrazide
- 1H-Indazole-3-carboxylic acid, 5-chloro-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.