CAS 1203-98-1

5-Fluoro-1H-indazole-3-carboxylic acid hydrazide

Description:

5-Fluoro-1H-indazole-3-carboxylic acid hydrazide is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluoro group at the 5-position enhances its reactivity and potential biological activity. The carboxylic acid and hydrazide functional groups contribute to its solubility and reactivity, making it a versatile compound in synthetic chemistry and medicinal chemistry. This compound may exhibit various pharmacological properties, including potential anti-inflammatory or antimicrobial activities, due to the presence of the hydrazide moiety. Its molecular structure allows for hydrogen bonding, which can influence its interactions with biological targets. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 5-Fluoro-1H-indazole-3-carboxylic acid hydrazide is of interest in research for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₈H₇FN₄O

InChI: InChI=1S/C8H7FN4O/c9-4-1-2-6-5(3-4)7(13-12-6)8(14)11-10/h1-3H,10H2,(H,11,14)(H,12,13)

InChI key: InChIKey=XWRJWHUJTCYRJO-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C=2C(NN1)=CC=C(F)C2

Synonyms:

• 5-Fluoro-1H-indazole-3-carboxylic acid hydrazide
• 1H-Indazole-3-carboxylic acid, 5-fluoro-, hydrazide