CAS 120315-65-3

4-Bromo-3-methoxybenzonitrile

Description:

4-Bromo-3-methoxybenzonitrile, with the CAS number 120315-65-3, is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a nitrile functional group attached to a benzene ring. This compound typically appears as a solid at room temperature and is often used in organic synthesis and pharmaceutical research due to its unique structural features. The bromine substituent can enhance the reactivity of the aromatic ring, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group contributes to the compound's electronic properties, influencing its reactivity and solubility in organic solvents. Additionally, the nitrile group imparts polar characteristics, which can affect the compound's interactions in biological systems. Overall, 4-Bromo-3-methoxybenzonitrile serves as a valuable building block in the synthesis of more complex organic molecules, particularly in the development of agrochemicals and pharmaceuticals.

Formula: C₈H₆BrNO

InChI: InChI=1/C8H6BrNO/c1-11-8-4-6(5-10)2-3-7(8)9/h2-4H,1H3

SMILES: COc1cc(ccc1Br)C#N

Synonyms:

• 2-Methoxy-4-Cyano-Bromobenzene

4-Bromo-3-methoxybenzonitrile

CAS: 120315-65-3

Formula: C₈H₆BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.0433

Ref: IN-DA00815R

4-Bromo-3-methoxybenzonitrile

CAS: 120315-65-3

4-Bromo-3-methoxybenzonitrile

Purity: 97%

Molecular weight: 212.04g/mol

Ref: 54-OR46048

4-Bromo-3-methoxybenzonitrile

CAS: 120315-65-3

Formula: C₈H₆BrNO

Purity: 98%

Color and Shape: White powder

Molecular weight: 212.046

Ref: 10-F092342