CAS 120321-66-6

1-Butyl-1H-benzotriazole-5-carboxylic acid

Description:

1-Butyl-1H-benzotriazole-5-carboxylic acid is an organic compound characterized by its benzotriazole structure, which is known for its UV-absorbing properties. This compound features a butyl group attached to the nitrogen of the benzotriazole ring and a carboxylic acid functional group, contributing to its solubility and reactivity. It is typically used as a corrosion inhibitor and UV stabilizer in various applications, including coatings, plastics, and other materials exposed to sunlight. The presence of the carboxylic acid group enhances its ability to form hydrogen bonds, potentially improving its interaction with other substances. Additionally, its unique structure allows it to absorb UV radiation effectively, making it valuable in protecting materials from photodegradation. Safety data sheets indicate that it should be handled with care, as with many chemical substances, due to potential irritant properties. Overall, 1-butyl-1H-benzotriazole-5-carboxylic acid is significant in industrial applications where UV protection and corrosion resistance are essential.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-2-3-6-14-10-5-4-8(11(15)16)7-9(10)12-13-14/h4-5,7H,2-3,6H2,1H3,(H,15,16)

InChI key: InChIKey=XJQNSWOCRCXWHF-UHFFFAOYSA-N

SMILES: C(CCC)N1C=2C(=CC(C(O)=O)=CC2)N=N1

Synonyms:

• 1-Butyl-1H-benzotriazole-5-carboxylic acid
• 1H-Benzotriazole-5-carboxylic acid, 1-butyl-