CAS 120321-72-4

1-Methyl-1H-benzotriazole-5-methanol

Description:

1-Methyl-1H-benzotriazole-5-methanol, with the CAS number 120321-72-4, is an organic compound that features a benzotriazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound is characterized by the presence of a methyl group and a hydroxymethyl group, which contribute to its chemical reactivity and solubility properties. Benzotriazoles are known for their applications as corrosion inhibitors, UV stabilizers, and in various chemical syntheses. The hydroxymethyl group enhances its potential for hydrogen bonding, influencing its interactions in solution and with other molecules. Additionally, the methyl substitution can affect the compound's lipophilicity and overall stability. The compound's unique structure allows it to participate in various chemical reactions, making it valuable in both industrial and research applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₈H₉N₃O

InChI: InChI=1S/C8H9N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-4,12H,5H2,1H3

InChI key: InChIKey=HVLCKOBNGNRDPT-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(CO)=CC2)N=N1

Synonyms:

• (1-Methylbenzotriazol-5-Yl)Methanol
• (1-methyl-1H-benzo[d][1,2,3]triazol-5-yl)methanol
• 1-Methyl-1H-benzotriazole-5-methanol
• 1H-Benzotriazole-5-methanol, 1-methyl-
• (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methanol

(1-Methyl-1H-benzo[d][1,2,3]triazol-5-yl)methanol

CAS: 120321-72-4

Formula: C₈H₉N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.1766

Ref: IN-DA00386P

(1-Methyl-1H-1,2,3-benzotriazol-5-yl)methanol

CAS: 120321-72-4

(1-Methyl-1H-1,2,3-benzotriazol-5-yl)methanol

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 163.18g/mol

Ref: 54-OR23373