CymitQuimica logo

CAS 1203295-44-6

:

Benzyl 3-aminoazetidine-1-carboxylate hydrochloride

Description:
Benzyl 3-aminoazetidine-1-carboxylate hydrochloride is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a benzyl group, which contributes to its lipophilicity and potential biological activity. The presence of the amino group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylate moiety suggests that it can act as an acid, while the hydrochloride form indicates that it is a salt, enhancing its solubility in polar solvents, particularly water. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets and its pharmacokinetic profile. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H15ClN2O2
InChI:InChI=1S/C11H14N2O2.ClH/c12-10-6-13(7-10)11(14)15-8-9-4-2-1-3-5-9;/h1-5,10H,6-8,12H2;1H
InChI key:XUMHHJPWIBFPJM-UHFFFAOYSA-N
SMILES:C1C(CN1C(=O)OCC2=CC=CC=C2)N.Cl
Found 2 products.