CAS 120338-77-4
:3,5-BIS(DIMETHYLAMINO)BENZAMIDE
Description:
3,5-Bis(dimethylamino)benzamide is an organic compound characterized by its amide functional group and the presence of two dimethylamino substituents on the benzene ring. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to the presence of the dimethylamino groups, which can engage in hydrogen bonding. The dimethylamino groups contribute to its basicity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure suggests that it may exhibit interesting electronic properties, which could be leveraged in applications such as dyes, pharmaceuticals, or as a building block in organic synthesis. Additionally, the presence of multiple amino groups may enhance its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with amine functionalities can pose health risks if not managed properly.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-13(2)9-5-8(11(12)15)6-10(7-9)14(3)4/h5-7H,1-4H3,(H2,12,15)
SMILES:CN(C)c1cc(cc(c1)N(C)C)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
