CymitQuimica logo

CAS 120341-04-0

:

1-AMINOBENZIMIDAZOLE-2-SULFONIC ACID

Description:
1-Aminobenzimidazole-2-sulfonic acid is an organic compound characterized by its benzimidazole core, which features an amino group and a sulfonic acid group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. It is often used in various chemical applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The sulfonic acid group contributes to its acidic properties, making it a potential candidate for use in buffer solutions. Additionally, the amino group can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The compound's structure allows for potential interactions with biological systems, which may be explored in medicinal chemistry. Overall, 1-aminobenzimidazole-2-sulfonic acid is a versatile compound with significant utility in both research and industrial applications.
Formula:C7H7N3O3S
InChI:InChI=1/C7H7N3O3S/c8-10-6-4-2-1-3-5(6)9-7(10)14(11,12)13/h1-4H,8H2,(H,11,12,13)
SMILES:c1ccc2c(c1)nc(n2N)S(=O)(=O)O
Synonyms:
  • 1-Aminobenzimidazole-2-Sulfonic Acid 99%
  • 1-amino-1H-benzimidazole-2-sulfonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.