
CAS 120347-75-3
:Boronic acid, 3-pyrrolidinyl-
Description:
Boronic acid, 3-pyrrolidinyl- (CAS 120347-75-3) is an organic compound characterized by the presence of a boronic acid functional group attached to a pyrrolidine ring. This compound typically exhibits properties associated with both boron and nitrogen functionalities, making it a versatile intermediate in organic synthesis. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is a key feature in applications such as Suzuki coupling reactions in cross-coupling chemistry. The pyrrolidine moiety contributes to the compound's basicity and potential for forming hydrogen bonds, enhancing its reactivity in various chemical transformations. Additionally, the presence of the boron atom can influence the compound's solubility and stability in different solvents. Overall, boronic acids like 3-pyrrolidinyl- are valuable in medicinal chemistry and materials science due to their unique reactivity and ability to participate in diverse chemical reactions.
Formula:C4H10BNO2
InChI:InChI=1S/C4H10BNO2/c7-5(8)4-1-2-6-3-4/h4,6-8H,1-3H2
InChI key:InChIKey=ZXXYWZUJUOXWEB-UHFFFAOYSA-N
SMILES:B(O)(O)C1CCNC1
Synonyms:- (Pyrrolidin-3-yl)boronic acid
- 3-Pyrrolidinylboronic acid
- Boronic acid, 3-pyrrolidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
