CymitQuimica logo

CAS 1203498-93-4

:

N-(2-Bromo-5-iodo-3-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(2-Bromo-5-iodo-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with bromine and iodine atoms, contributing to its reactivity and potential biological activity. The presence of the amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The bulky 2,2-dimethylpropanamide moiety may affect the compound's steric properties, potentially impacting its pharmacokinetics and binding affinity in biological systems. This compound is likely to exhibit specific properties such as lipophilicity, which can influence its absorption and distribution in living organisms. Additionally, the halogen substituents (bromine and iodine) may enhance its reactivity, making it a candidate for various chemical reactions or as a lead compound in drug discovery. Overall, the combination of these features suggests that N-(2-Bromo-5-iodo-3-pyridinyl)-2,2-dimethylpropanamide could have significant applications in medicinal chemistry and related fields.
Formula:C10H12BrIN2O
InChI:InChI=1S/C10H12BrIN2O/c1-10(2,3)9(15)14-7-4-6(12)5-13-8(7)11/h4-5H,1-3H3,(H,14,15)
InChI key:InChIKey=ZYYADPLXQGZEAM-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Br)N=CC(I)=C1
Synonyms:
  • Propanamide, N-(2-bromo-5-iodo-3-pyridinyl)-2,2-dimethyl-
  • N-(2-Bromo-5-iodo-3-pyridinyl)-2,2-dimethylpropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.