CAS 1203498-96-7
:3-[4-(Phenylmethoxy)-3-pyridinyl]-2-propyn-1-ol
Description:
3-[4-(Phenylmethoxy)-3-pyridinyl]-2-propyn-1-ol, identified by its CAS number 1203498-96-7, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a propynol functional group. This compound features a phenylmethoxy substituent, contributing to its potential as a pharmacological agent. The presence of the hydroxyl group (-OH) indicates that it may exhibit alcohol-like properties, influencing its solubility and reactivity. The pyridine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its structural features may allow for hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Additionally, the compound's unique arrangement of functional groups may impart specific characteristics such as lipophilicity or hydrophilicity, affecting its absorption and distribution in biological systems. Overall, this compound's intricate structure positions it as a candidate for further research in drug development and related fields.
Formula:C15H13NO2
InChI:InChI=1S/C15H13NO2/c17-10-4-7-14-11-16-9-8-15(14)18-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,17H,10,12H2
InChI key:InChIKey=YFUDPXJYMLQHQO-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C(C#CCO)=CN=CC2
Synonyms:- 3-[4-(Phenylmethoxy)-3-pyridinyl]-2-propyn-1-ol
- 2-Propyn-1-ol, 3-[4-(phenylmethoxy)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.