CAS 1203499-04-0
:2-Chloro-5-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodopyridine
Description:
2-Chloro-5-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodopyridine is a complex organic compound characterized by its unique structural features, including a pyridine ring substituted with chlorine and iodine atoms, as well as a pyrrolidine moiety. The presence of a dimethylsilyl group indicates that the compound has potential applications in organosilicon chemistry, possibly enhancing its stability and solubility. The tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological properties due to its structural diversity, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be assessed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. Overall, the compound's unique combination of functional groups and substituents suggests potential utility in various chemical and pharmaceutical applications.
Formula:C16H26ClIN2OSi
InChI:InChI=1S/C16H26ClIN2OSi/c1-16(2,3)22(4,5)21-11-12-6-7-20(10-12)13-8-14(18)15(17)19-9-13/h8-9,12H,6-7,10-11H2,1-5H3
InChI key:InChIKey=LHQXTKWGOAUMSV-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2C=C(I)C(Cl)=NC2
Synonyms:- Pyridine, 2-chloro-5-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodo-
- 2-Chloro-5-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodopyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.