CAS 1203499-05-1
:2-Fluoro-6-(1-pyrrolidinyl)-3-[2-(trimethylsilyl)ethynyl]pyridine
Description:
2-Fluoro-6-(1-pyrrolidinyl)-3-[2-(trimethylsilyl)ethynyl]pyridine is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with a fluorine atom, a pyrrolidine moiety, and a trimethylsilyl-ethynyl group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, making it potentially useful in medicinal chemistry. The pyrrolidine group can contribute to the compound's ability to interact with biological targets, while the trimethylsilyl group can enhance stability and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, detailed studies on its reactivity, stability, and biological effects are necessary to fully understand its characteristics and potential uses.
Formula:C14H19FN2Si
InChI:InChI=1S/C14H19FN2Si/c1-18(2,3)11-8-12-6-7-13(16-14(12)15)17-9-4-5-10-17/h6-7H,4-5,9-10H2,1-3H3
InChI key:InChIKey=FBJLOPDZKMCJGG-UHFFFAOYSA-N
SMILES:FC1=NC(=CC=C1C#C[Si](C)(C)C)N2CCCC2
Synonyms:- 2-Fluoro-6-(1-pyrrolidinyl)-3-[2-(trimethylsilyl)ethynyl]pyridine
- Pyridine, 2-fluoro-6-(1-pyrrolidinyl)-3-[2-(trimethylsilyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.