CymitQuimica logo

CAS 1203499-06-2

:

6-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]furo[3,2-b]pyridine

Description:
6-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]furo[3,2-b]pyridine is a complex organic compound characterized by its unique structural features, which include a furo[3,2-b]pyridine core, a bromine substituent, and a silyl ether functional group. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the dimethylsilyl group enhances the compound's stability and solubility in organic solvents. The pyrrolidine moiety contributes to the compound's potential biological activity, as such nitrogen-containing heterocycles are often associated with pharmacological properties. Additionally, the compound's structure indicates it may exhibit lipophilicity due to the bulky tert-butyl group, which can influence its interaction with biological membranes. Overall, this compound's intricate architecture and functional groups suggest it may be of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.
Formula:C19H29BrN2O2Si
InChI:InChI=1S/C19H29BrN2O2Si/c1-19(2,3)25(4,5)23-13-14-6-7-22(11-14)12-16-9-17-18(24-16)8-15(20)10-21-17/h8-10,14H,6-7,11-13H2,1-5H3
InChI key:InChIKey=ISUUPZMZHJRJOL-UHFFFAOYSA-N
SMILES:C(C1=CC=2C(O1)=CC(Br)=CN2)N3CC(CO[Si](C(C)(C)C)(C)C)CC3
Synonyms:
  • 6-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]furo[3,2-b]pyridine
  • Furo[3,2-b]pyridine, 6-bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.