CAS 1203499-07-3

N-(2-Formylfuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide

Description:

N-(2-Formylfuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a furo[3,2-b]pyridine moiety and an amide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the formyl group suggests that it may participate in various chemical reactions, such as condensation or nucleophilic addition. The bulky 2,2-dimethylpropanamide group can influence the compound's solubility and steric hindrance, potentially affecting its interactions with biological targets. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Further investigation into its chemical behavior and biological activity would provide a more comprehensive understanding of its potential applications.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1S/C13H14N2O3/c1-13(2,3)12(17)15-9-4-5-14-10-6-8(7-16)18-11(9)10/h4-7H,1-3H3,(H,14,15,17)

InChI key: InChIKey=XVHKFHXHYNDZBK-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C2C(C=C(C=O)O2)=NC=C1

Synonyms:

• Propanamide, N-(2-formylfuro[3,2-b]pyridin-7-yl)-2,2-dimethyl-
• N-(2-Formylfuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide
• N-(2-Formylfuro[3,2-b]pyridin-7-yl)pivalamide