CymitQuimica logo

CAS 1203499-11-9

:

N-(3-Hydroxy-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(3-Hydroxy-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a hydroxyl group and a methyl group, alongside a bulky 2,2-dimethylpropanamide moiety. This compound is likely to exhibit polar characteristics due to the presence of the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The presence of the pyridine ring suggests potential aromatic properties, contributing to its stability and reactivity. Additionally, the bulky dimethylpropanamide group may impart steric hindrance, affecting its interaction with biological targets or other chemical species. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can play a role in biological activity. Overall, the characteristics of this compound, including its solubility, reactivity, and potential biological interactions, make it a subject of interest in various fields of chemical research.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-7-5-8(14)9(12-6-7)13-10(15)11(2,3)4/h5-6,14H,1-4H3,(H,12,13,15)
InChI key:InChIKey=RZYQPAXMKHZVFX-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(O)C=C(C)C=N1
Synonyms:
  • Propanamide, N-(3-hydroxy-5-methyl-2-pyridinyl)-2,2-dimethyl-
  • N-(3-Hydroxy-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.