CAS 1203499-15-3

6-(2-Propen-1-yl)-2-(trimethylsilyl)furo[3,2-b]pyridine

Description:

6-(2-Propen-1-yl)-2-(trimethylsilyl)furo[3,2-b]pyridine is a chemical compound characterized by its unique structural features, which include a furo[3,2-b]pyridine core, a propenyl substituent, and a trimethylsilyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the trimethylsilyl group enhances its lipophilicity and may influence its solubility in organic solvents. Additionally, the propenyl group can participate in various chemical reactions, such as polymerization or cross-coupling reactions, making it a versatile intermediate in organic synthesis. The compound may also exhibit interesting biological activities, although specific biological data would depend on empirical studies. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of novel compounds with tailored properties. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₃H₁₇NOSi

InChI: InChI=1S/C13H17NOSi/c1-5-6-10-7-12-11(14-9-10)8-13(15-12)16(2,3)4/h5,7-9H,1,6H2,2-4H3

InChI key: InChIKey=KSIXFIRSSFJEIB-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C=1OC=2C(C1)=NC=C(CC=C)C2

Synonyms:

• Furo[3,2-b]pyridine, 6-(2-propen-1-yl)-2-(trimethylsilyl)-
• 6-(2-Propen-1-yl)-2-(trimethylsilyl)furo[3,2-b]pyridine