CAS 1203499-20-0
:1,1-Dimethylethyl 3-[[(5-bromo-3-formyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(5-bromo-3-formyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate is a complex organic compound characterized by its unique structural features, which include a pyrrolidine ring and a pyridine moiety. The presence of a bromine atom and a formyl group on the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. The ester functional group in the carboxylate portion suggests that the compound may exhibit properties typical of esters, such as volatility and solubility in organic solvents. Additionally, the dimethyl substituents on the pyrrolidine ring may influence the steric and electronic properties of the molecule, potentially affecting its biological activity. This compound may be of interest in the development of pharmaceuticals or agrochemicals due to its structural complexity and the presence of reactive functional groups. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H21BrN2O4
InChI:InChI=1S/C16H21BrN2O4/c1-16(2,3)23-15(21)19-5-4-11(8-19)10-22-14-12(9-20)6-13(17)7-18-14/h6-7,9,11H,4-5,8,10H2,1-3H3
InChI key:InChIKey=YAJQRHYUMDOISZ-UHFFFAOYSA-N
SMILES:O(CC1CN(C(OC(C)(C)C)=O)CC1)C2=C(C=O)C=C(Br)C=N2
Synonyms:- 1,1-Dimethylethyl 3-[[(5-bromo-3-formyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[[(5-bromo-3-formyl-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.