CymitQuimica logo

CAS 1203499-23-3

:

2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde

Description:
2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom and a pyrrolidine moiety. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine group may contribute to the compound's ability to interact with biological targets, potentially affecting its pharmacological properties. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions, due to the electrophilic nature of the aldehyde group. Overall, 2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde is a versatile compound with potential applications in drug development and synthetic chemistry, warranting further investigation into its properties and uses.
Formula:C10H11FN2O
InChI:InChI=1S/C10H11FN2O/c11-10-8(7-14)3-4-9(12-10)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2
InChI key:InChIKey=PGLUHADCVQGJMP-UHFFFAOYSA-N
SMILES:FC1=NC(=CC=C1C=O)N2CCCC2
Synonyms:
  • 2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde
  • 2-Fluoro-6-pyrrolidin-1-ylpyridine-3-carbaldehyde
  • 3-Pyridinecarboxaldehyde, 2-fluoro-6-(1-pyrrolidinyl)-
  • 2-Fluoro-6-(pyrrolidin-1-yl)nicotinaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.