CymitQuimica logo

CAS 1203499-24-4

:

1,1-Dimethylethyl 2,3-dihydro-5-[2-(trimethylsilyl)ethynyl]-1H-pyrido[3,4-b][1,4]oxazine-1-carboxylate

Description:
1,1-Dimethylethyl 2,3-dihydro-5-[2-(trimethylsilyl)ethynyl]-1H-pyrido[3,4-b][1,4]oxazine-1-carboxylate, identified by its CAS number 1203499-24-4, is a complex organic compound characterized by its unique structural features. It contains a pyrido[3,4-b][1,4]oxazine core, which is a bicyclic structure that incorporates both nitrogen and oxygen heteroatoms, contributing to its potential biological activity. The presence of a trimethylsilyl group indicates that the compound may exhibit enhanced stability and solubility, making it suitable for various applications in organic synthesis or medicinal chemistry. The dimethyl group attached to the ethyl moiety suggests steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Additionally, the carboxylate functional group may impart acidic properties, affecting its solubility and reactivity in different environments. Overall, this compound's intricate structure and functional groups suggest potential utility in pharmaceutical development or as a synthetic intermediate in organic chemistry.
Formula:C17H24N2O3Si
InChI:InChI=1S/C17H24N2O3Si/c1-17(2,3)22-16(20)19-10-11-21-15-13(8-12-23(4,5)6)18-9-7-14(15)19/h7,9H,10-11H2,1-6H3
InChI key:InChIKey=BLJXYAVCSGBWNF-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(=C(C#C[Si](C)(C)C)N=CC2)OCC1
Synonyms:
  • 1,1-Dimethylethyl 2,3-dihydro-5-[2-(trimethylsilyl)ethynyl]-1H-pyrido[3,4-b][1,4]oxazine-1-carboxylate
  • 1H-Pyrido[3,4-b][1,4]oxazine-1-carboxylic acid, 2,3-dihydro-5-[2-(trimethylsilyl)ethynyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.