CAS 1203499-25-5
:6-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Description:
6-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and an oxazine ring. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties associated with heterocycles, such as moderate to high solubility in polar solvents and potential biological activity due to its structural features. The oxazinone moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit fluorescence or other optical properties, making it of interest in materials science and organic synthesis. Its specific interactions and stability can be influenced by the substituents on the rings and the overall electronic environment. As with many heterocycles, it may also show potential as a pharmacophore in drug development, warranting further investigation into its biological activity and therapeutic applications.
Formula:C7H5IN2O2
InChI:InChI=1S/C7H5IN2O2/c8-5-2-1-4-7(10-5)12-3-6(11)9-4/h1-2H,3H2,(H,9,11)
InChI key:InChIKey=XGPPXLXJNTXAQP-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=NC(I)=CC2)OC1
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 6-iodo-
- 6-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.