CAS 1203499-29-9
:7-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Description:
7-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and an oxazine ring. The presence of the iodine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its structure suggests potential biological activity, making it of interest in drug discovery and development. The oxazinone moiety may also impart specific chemical reactivity, allowing for further derivatization. As with many heterocycles, the electronic properties of the nitrogen and oxygen atoms in the rings can influence its interaction with biological targets. Overall, 7-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one represents a class of compounds that could be explored for their pharmacological potential and synthetic utility in organic chemistry.
Formula:C7H5IN2O2
InChI:InChI=1S/C7H5IN2O2/c8-4-1-5-7(9-2-4)12-3-6(11)10-5/h1-2H,3H2,(H,10,11)
InChI key:InChIKey=FJGDEJWGCXCKOI-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=NC=C(I)C2)OC1
Synonyms:- 7-Iodo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
- 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 7-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.