CAS 1203499-33-5
:1,1-Dimethylethyl 3-[[(3-iodo-5-methyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(3-iodo-5-methyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1203499-33-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a pyridine moiety. The presence of the 3-iodo-5-methyl-2-pyridinyl group suggests potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The dimethylethyl group contributes to the compound's steric bulk, which may influence its reactivity and interaction with biological targets. This compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions. Its functional groups indicate that it may participate in hydrogen bonding and other intermolecular forces, affecting its solubility and stability. Overall, this compound's unique structural features make it a candidate for further investigation in medicinal chemistry and related fields.
Formula:C16H23IN2O3
InChI:InChI=1S/C16H23IN2O3/c1-11-7-13(17)14(18-8-11)21-10-12-5-6-19(9-12)15(20)22-16(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3
InChI key:InChIKey=CKROMISXVJDZFA-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(COC2=C(I)C=C(C)C=N2)CC1
Synonyms:- 1,1-Dimethylethyl 3-[[(3-iodo-5-methyl-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[[(3-iodo-5-methyl-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.