CymitQuimica logo

CAS 1203499-36-8

:

8-Iodo-1-[(4-methoxyphenyl)methyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

Description:
8-Iodo-1-[(4-methoxyphenyl)methyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a chemical compound characterized by its complex structure, which includes a pyrido[2,3-b][1,4]oxazine core. This compound features an iodine atom at the 8-position, which can influence its reactivity and biological activity. The presence of a methoxyphenyl group enhances its lipophilicity and may contribute to its pharmacological properties. The oxazine moiety suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's unique structure may also confer specific interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of halogen (iodine) can facilitate various chemical reactions, such as nucleophilic substitutions. Overall, this compound's characteristics, including its molecular framework and substituents, position it as a potentially valuable entity in research and development within the fields of organic and medicinal chemistry.
Formula:C15H13IN2O3
InChI:InChI=1S/C15H13IN2O3/c1-20-11-4-2-10(3-5-11)8-18-13(19)9-21-15-14(18)12(16)6-7-17-15/h2-7H,8-9H2,1H3
InChI key:InChIKey=HHASLJWLUTWBFA-UHFFFAOYSA-N
SMILES:C(N1C=2C(OCC1=O)=NC=CC2I)C3=CC=C(OC)C=C3
Synonyms:
  • 8-Iodo-1-[(4-methoxyphenyl)methyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
  • 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 8-iodo-1-[(4-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.