CAS 1203499-39-1
:N-(2-Cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide
Description:
N-(2-Cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a furo[3,2-b]pyridine moiety and a dimethylpropanamide group. This compound features a cyano group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the furo[3,2-b]pyridine structure suggests potential biological activity, as many compounds containing this framework have been studied for their pharmacological properties. The dimethylpropanamide portion enhances the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. As with many synthetic organic compounds, its stability, reactivity, and interactions with biological targets would depend on various factors, including pH, temperature, and the presence of other chemical species. Overall, this compound may be of interest in research areas such as drug development and materials science, although specific applications would require further investigation into its properties and behavior in different environments.
Formula:C13H13N3O2
InChI:InChI=1S/C13H13N3O2/c1-13(2,3)12(17)16-9-4-5-15-10-6-8(7-14)18-11(9)10/h4-6H,1-3H3,(H,15,16,17)
InChI key:InChIKey=IHPVDBFKYPBQHI-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C2C(C=C(C#N)O2)=NC=C1
Synonyms:- N-(2-Cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide
- Propanamide, N-(2-cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.