CAS 1203499-40-4
:7-Iodo-1-(phenylmethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Description:
7-Iodo-1-(phenylmethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine ring fused with an oxazine moiety. The presence of the iodo substituent at the 7-position enhances its reactivity and may influence its biological activity. The phenylmethyl group contributes to the compound's lipophilicity, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's stability, reactivity, and interaction with other molecules can be influenced by the presence of the iodine atom and the phenylmethyl group, which may also play a role in its mechanism of action. Overall, 7-Iodo-1-(phenylmethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one represents a fascinating subject for further investigation in the fields of organic and medicinal chemistry.
Formula:C14H11IN2O2
InChI:InChI=1S/C14H11IN2O2/c15-11-6-12-14(16-7-11)19-9-13(18)17(12)8-10-4-2-1-3-5-10/h1-7H,8-9H2
InChI key:InChIKey=BKGCQXKQWKTXCS-UHFFFAOYSA-N
SMILES:C(N1C=2C(OCC1=O)=NC=C(I)C2)C3=CC=CC=C3
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 7-iodo-1-(phenylmethyl)-
- 7-Iodo-1-(phenylmethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.