CAS 1203499-41-5

6-(3-Hydroxy-1-propyn-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

Description:

6-(3-Hydroxy-1-propyn-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine ring fused to an oxazine moiety. The presence of a hydroxyl group and a propynyl substituent contributes to its reactivity and potential biological activity. This compound may exhibit properties typical of both heterocycles and alkynes, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. As with many heterocyclic compounds, it may also display interesting electronic properties due to the delocalization of electrons within the aromatic systems. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug discovery and materials science.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c13-5-1-2-7-3-4-8-10(11-7)15-6-9(14)12-8/h3-4,13H,5-6H2,(H,12,14)

InChI key: InChIKey=LMHVWSKVTSDZBP-UHFFFAOYSA-N

SMILES: C(#CCO)C=1N=C2C(=CC1)NC(=O)CO2

Synonyms:

• 6-(3-Hydroxy-1-propyn-1-yl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
• 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 6-(3-hydroxy-1-propyn-1-yl)-