CymitQuimica logo

CAS 1203499-42-6

:

6-[2-(Trimethylsilyl)ethynyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

Description:
6-[2-(Trimethylsilyl)ethynyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, with the CAS number 1203499-42-6, is a chemical compound characterized by its unique structural features, including a pyrido[2,3-b][1,4]oxazine core and a trimethylsilyl group attached via an ethynyl linkage. This compound exhibits properties typical of heterocyclic compounds, which may include potential biological activity due to the presence of nitrogen and oxygen in its structure. The trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. Additionally, the ethynyl group can participate in further chemical reactions, such as cross-coupling or click chemistry, facilitating the development of more complex molecules. The compound's specific reactivity and applications would depend on its functional groups and the context of its use in organic synthesis or medicinal chemistry. Overall, this compound represents a versatile building block in the field of organic chemistry.
Formula:C12H14N2O2Si
InChI:InChI=1S/C12H14N2O2Si/c1-17(2,3)7-6-9-4-5-10-12(13-9)16-8-11(15)14-10/h4-5H,8H2,1-3H3,(H,14,15)
InChI key:InChIKey=FRBGNSZWKAUYEJ-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C=1N=C2C(NC(=O)CO2)=CC1
Synonyms:
  • 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 6-[2-(trimethylsilyl)ethynyl]-
  • 6-[2-(Trimethylsilyl)ethynyl]-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.