CAS 1203499-48-2
:2-Amino-6-methyl-1,8-naphthyridine-3-carbonitrile
Description:
2-Amino-6-methyl-1,8-naphthyridine-3-carbonitrile is a heterocyclic organic compound characterized by its naphthyridine core, which features a fused bicyclic structure containing nitrogen atoms. This compound contains an amino group (-NH2) and a cyano group (-C≡N), contributing to its reactivity and potential biological activity. The presence of the methyl group at the 6-position enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the naphthyridine framework is known for its role in various biological activities, making this compound of interest for further research in drug discovery and development. Its CAS number, 1203499-48-2, allows for easy identification and retrieval of information related to its properties, synthesis, and applications in scientific literature.
Formula:C10H8N4
InChI:InChI=1S/C10H8N4/c1-6-2-7-3-8(4-11)9(12)14-10(7)13-5-6/h2-3,5H,1H3,(H2,12,13,14)
InChI key:InChIKey=AWOYWYUGJKKFNO-UHFFFAOYSA-N
SMILES:C(#N)C1=CC2=C(N=C1N)N=CC(C)=C2
Synonyms:- 1,8-Naphthyridine-3-carbonitrile, 2-amino-6-methyl-
- 2-Amino-6-methyl-1,8-naphthyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.