CAS 1203499-52-8

N-(2-Chloro-3-methyl-4-pyridinyl)-2,2-dimethylpropanamide

Description:

N-(2-Chloro-3-methyl-4-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a methyl group, alongside a branched amide functional group. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its pyridine moiety. The presence of the chlorine atom may influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the bulky 2,2-dimethylpropanamide group can affect the compound's steric properties and overall stability. As with many organic compounds, its behavior in various chemical environments, including its reactivity and potential applications, can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound may be explored for its potential applications in pharmaceuticals or agrochemicals, although specific studies would be necessary to elucidate its full range of characteristics and uses.

Formula: C₁₁H₁₅ClN₂O

InChI: InChI=1S/C11H15ClN2O/c1-7-8(5-6-13-9(7)12)14-10(15)11(2,3)4/h5-6H,1-4H3,(H,13,14,15)

InChI key: InChIKey=WICFYEIKXTVWJR-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C(C)=C(Cl)N=CC1

Synonyms:

• N-(2-Chloro-3-methyl-4-pyridinyl)-2,2-dimethylpropanamide
• Propanamide, N-(2-chloro-3-methyl-4-pyridinyl)-2,2-dimethyl-
• N-(2-Chloro-3-methyl-4-pyridyl)-2,2-dimethylpropanamide