CAS 1203499-54-0
:4-Hydroxy-3-pyridinepropanol
Description:
4-Hydroxy-3-pyridinepropanol, identified by its CAS number 1203499-54-0, is a chemical compound characterized by its pyridine and alcohol functional groups. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity and interaction with various receptors. The presence of a hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The propanol moiety suggests that it has a three-carbon chain with an alcohol functional group, which may influence its reactivity and stability. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological systems. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from research in drug development to potential use in agrochemicals or other industrial applications. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c10-5-1-2-7-6-9-4-3-8(7)11/h3-4,6,10H,1-2,5H2,(H,9,11)
InChI key:InChIKey=QUIBROFPPNWBPO-UHFFFAOYSA-N
SMILES:C(CCO)C=1C(O)=CC=NC1
Synonyms:- 3-Pyridinepropanol, 4-hydroxy-
- 4-Hydroxy-3-pyridinepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
