CAS 1203499-55-1

2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid

Description:

2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2 and 6 positions. The presence of a fluorine atom at the 2-position and a pyrrolidine group at the 6-position contributes to its unique properties. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The pyrrolidine moiety may influence its biological activity, potentially affecting its interaction with biological targets. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, given the presence of the pyrrolidine ring. Overall, 2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid represents a compound with intriguing chemical properties and potential therapeutic applications.

Formula: C₁₀H₁₁FN₂O₂

InChI: InChI=1S/C10H11FN2O2/c11-9-7(10(14)15)3-4-8(12-9)13-5-1-2-6-13/h3-4H,1-2,5-6H2,(H,14,15)

InChI key: InChIKey=SLLMHRMILPEKNY-UHFFFAOYSA-N

SMILES: FC1=NC(=CC=C1C(O)=O)N2CCCC2

Synonyms:

• 2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-fluoro-6-(1-pyrrolidinyl)-