CAS 1203499-62-0

3-(4-Chloro-3-pyridinyl)-2-propyn-1-ol

Description:

3-(4-Chloro-3-pyridinyl)-2-propyn-1-ol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a propynol functional group. The presence of the chloro substituent on the pyridine ring enhances its reactivity and may influence its biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents due to the hydroxyl group (-OH) and potential hydrophobic characteristics from the aromatic ring. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological activities. Additionally, the presence of the triple bond in the propynyl group may allow for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly due to the presence of chlorine, which can pose health risks.

Formula: C₈H₆ClNO

InChI: InChI=1S/C8H6ClNO/c9-8-3-4-10-6-7(8)2-1-5-11/h3-4,6,11H,5H2

InChI key: InChIKey=MBJUURQWRLDNBQ-UHFFFAOYSA-N

SMILES: C(#CCO)C=1C(Cl)=CC=NC1

Synonyms:

• 2-Propyn-1-ol, 3-(4-chloro-3-pyridinyl)-
• 3-(4-Chloro-3-pyridinyl)-2-propyn-1-ol