CAS 1203499-66-4
:1-(1,1-Dimethylethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Description:
1-(1,1-Dimethylethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, identified by its CAS number 1203499-66-4, is a chemical compound that features a complex bicyclic structure incorporating a pyridine and an oxazine moiety. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) which contributes to its steric bulk and may influence its reactivity and solubility. The oxazinone functional group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to participate in various chemical reactions. The compound's unique structure may also impart specific biological activities, making it of interest for further research. Its physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, and its stability under various conditions would be crucial for practical applications. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic utility.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-11(2,3)13-8-5-4-6-12-10(8)15-7-9(13)14/h4-6H,7H2,1-3H3
InChI key:InChIKey=NXHJESYEVATZBG-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=2C(OCC1=O)=NC=CC2
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 1-(1,1-dimethylethyl)-
- 1-(1,1-Dimethylethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.