CymitQuimica logo

CAS 1203499-67-5

:

2,3-Dihydro-1-[(4-methoxyphenyl)methyl]-2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carbonitrile

Description:
2,3-Dihydro-1-[(4-methoxyphenyl)methyl]-2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carbonitrile is a complex organic compound characterized by its unique structural features, which include a pyrido[2,3-b][1,4]oxazine core. This compound typically exhibits a range of chemical properties due to the presence of functional groups such as a carbonitrile and a methoxyphenyl moiety. The carbonitrile group contributes to its potential reactivity, while the methoxy group can influence its solubility and polarity. The compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's stability, solubility in organic solvents, and reactivity with other chemical species can vary based on environmental conditions. Overall, this substance represents a fascinating area of study within organic and medicinal chemistry, with implications for further research and application in therapeutic contexts.
Formula:C16H13N3O3
InChI:InChI=1S/C16H13N3O3/c1-21-13-5-2-11(3-6-13)9-19-14-7-4-12(8-17)18-16(14)22-10-15(19)20/h2-7H,9-10H2,1H3
InChI key:InChIKey=QOJIKPNQZBUFPH-UHFFFAOYSA-N
SMILES:C(N1C=2C(=NC(C#N)=CC2)OCC1=O)C3=CC=C(OC)C=C3
Synonyms:
  • 1H-Pyrido[2,3-b][1,4]oxazine-6-carbonitrile, 2,3-dihydro-1-[(4-methoxyphenyl)methyl]-2-oxo-
  • 2,3-Dihydro-1-[(4-methoxyphenyl)methyl]-2-oxo-1H-pyrido[2,3-b][1,4]oxazine-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.