CAS 1203499-68-6

6-Bromo-2-chloro-4-[2-(trimethylsilyl)ethynyl]-3-pyridinamine

Description:

6-Bromo-2-chloro-4-[2-(trimethylsilyl)ethynyl]-3-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine and chlorine atoms, as well as a trimethylsilyl group attached via an ethynyl linkage. This compound is notable for its potential applications in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals due to the presence of the pyridinamine moiety, which can enhance biological activity. The trimethylsilyl group is often utilized to improve solubility and stability, making the compound more amenable to various chemical reactions. Additionally, the presence of halogen substituents can influence the reactivity and interaction of the compound with biological targets. As with many synthetic organic compounds, handling and storage require adherence to safety protocols to mitigate risks associated with its chemical properties. Overall, 6-Bromo-2-chloro-4-[2-(trimethylsilyl)ethynyl]-3-pyridinamine exemplifies the intricate design often found in modern organic chemistry.

Formula: C₁₀H₁₂BrClN₂Si

InChI: InChI=1S/C10H12BrClN2Si/c1-15(2,3)5-4-7-6-8(11)14-10(12)9(7)13/h6H,13H2,1-3H3

InChI key: InChIKey=OAKKZZHXYRPKKE-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C=1C(N)=C(Cl)N=C(Br)C1

Synonyms:

• 3-Pyridinamine, 6-bromo-2-chloro-4-[2-(trimethylsilyl)ethynyl]-
• 6-Bromo-2-chloro-4-[2-(trimethylsilyl)ethynyl]-3-pyridinamine