CAS 1203500-12-2

Methyl 3-(2-amino-3-pyridinyl)-2-propenoate

Description:

Methyl 3-(2-amino-3-pyridinyl)-2-propenoate, identified by its CAS number 1203500-12-2, is an organic compound characterized by its structure, which features a methyl ester functional group and a pyridine ring substituted with an amino group. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of both esters and amines, which may influence its reactivity and interactions in chemical reactions. The presence of the pyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, owing to the functional groups present. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and could vary based on purity and environmental conditions.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1S/C9H10N2O2/c1-13-8(12)5-4-7-3-2-6-11-9(7)10/h2-6H,1H3,(H2,10,11)

InChI key: InChIKey=UPFAVCSTPFQWCW-UHFFFAOYSA-N

SMILES: C(=CC(OC)=O)C1=C(N)N=CC=C1

Synonyms:

• 2-Propenoic acid, 3-(2-amino-3-pyridinyl)-, methyl ester
• Methyl 3-(2-amino-3-pyridinyl)-2-propenoate