CymitQuimica logo

CAS 120351-94-2

:

3-(2-aminoethoxy)benzonitrile

Description:
3-(2-Aminoethoxy)benzonitrile, with the CAS number 120351-94-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a nitrile group (-C≡N) and an aminoethoxy group (-O-CH2-CH2-NH2). This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amino and ether functionalities, which can engage in hydrogen bonding. The amino group imparts basic properties, while the nitrile group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of both electron-withdrawing (nitrile) and electron-donating (amino) groups can influence its electronic properties, making it interesting for studies in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H10N2O
InChI:InChI=1/C9H10N2O/c10-4-5-12-9-3-1-2-8(6-9)7-11/h1-3,6H,4-5,10H2
InChI key:XRXLMRKNZYUOND-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OCCN)C#N
Synonyms:
  • Benzonitrile, 3-(2-aminoethoxy)-
  • 3-(2-Aminoethoxy)benzonitrile
  • 3-(2-Aminoethoxy)
Found 4 products.