CAS 120351-95-3

2-(4-propylphenoxy)ethanamine

Description:

2-(4-Propylphenoxy)ethanamine, with the CAS number 120351-95-3, is an organic compound characterized by its amine functional group and ether linkage. This substance features a propyl group attached to a phenyl ring, which is further connected to an ethanamine moiety. The presence of the propyl group enhances its hydrophobic characteristics, while the amine group contributes to its potential as a ligand in various chemical reactions. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds that interact with biological systems, such as neurotransmitter receptors. Additionally, the presence of the ether bond may influence its reactivity and stability under different conditions. Overall, 2-(4-propylphenoxy)ethanamine is a compound of interest in organic chemistry and medicinal chemistry, warranting further investigation into its properties and potential applications.

Formula: C₁₁H₁₇NO

InChI: InChI=1/C11H17NO/c1-2-3-10-4-6-11(7-5-10)13-9-8-12/h4-7H,2-3,8-9,12H2,1H3

SMILES: CCCc1ccc(cc1)OCCN

Synonyms:

• Ethanamine, 2-(4-Propylphenoxy)-