CAS 120351-96-4

2-(2,3-Dimethoxyphenoxy)ethanamine

Description:

2-(2,3-Dimethoxyphenoxy)ethanamine, with the CAS number 120351-96-4, is an organic compound characterized by its phenolic structure and amine functional group. This substance features a two-carbon ethylamine chain linked to a phenoxy group, which is further substituted with two methoxy groups at the 2 and 3 positions of the aromatic ring. The presence of these methoxy groups enhances the compound's lipophilicity and may influence its biological activity. Typically, compounds of this nature can exhibit various pharmacological properties, potentially acting as neurotransmitter modulators or having other therapeutic effects. The molecular structure suggests that it may participate in hydrogen bonding due to the amine group, which can affect its solubility and reactivity. Additionally, the compound's stability and reactivity can be influenced by the electron-donating nature of the methoxy groups, which can affect its interaction with biological targets. Overall, 2-(2,3-Dimethoxyphenoxy)ethanamine is of interest in medicinal chemistry and may have applications in drug development.

Formula: C₁₀H₁₅NO₃

InChI: InChI=1S/C10H15NO3/c1-12-8-4-3-5-9(10(8)13-2)14-7-6-11/h3-5H,6-7,11H2,1-2H3

InChI key: InChIKey=IUKXSDZTQMDZHN-UHFFFAOYSA-N

SMILES: O(C)C1=C(OCCN)C=CC=C1OC

Synonyms:

• Ethanamine, 2-(2,3-dimethoxyphenoxy)-
• 2-(2,3-Dimethoxyphenoxy)ethanamine