CAS 120354-21-4

3-amino-2,7-dimethyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one

Description:

3-amino-2,7-dimethyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a benzothieno and a pyrimidinone moiety. This compound features an amino group and two methyl groups, contributing to its chemical reactivity and potential biological activity. The presence of the tetrahydro configuration indicates that the compound is saturated in certain positions, which can influence its solubility and interaction with biological targets. It is typically synthesized through multi-step organic reactions involving the formation of the bicyclic framework and subsequent functionalization. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical transformations under different conditions. As with many heterocycles, its properties can be further explored through computational modeling and experimental studies.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-6-3-4-8-9(5-6)17-11-10(8)12(16)15(13)7(2)14-11/h6H,3-5,13H2,1-2H3

SMILES: CC1CCc2c(C1)sc1c2c(=O)n(c(C)n1)N

Synonyms:

• [1]benzothieno[2,3-d]pyrimidin-4(3H)-one, 3-amino-5,6,7,8-tetrahydro-2,7-dimethyl-