CAS 120354-22-5
:din-4-one
Description:
Din-4-one, identified by its CAS number 120354-22-5, is a chemical compound that belongs to the class of ketones, characterized by the presence of a carbonyl group (C=O) bonded to two carbon atoms. This compound typically exhibits properties common to ketones, such as being a colorless liquid or solid at room temperature, with a distinctive odor. Din-4-one may participate in various chemical reactions, including nucleophilic addition and oxidation, due to the reactivity of its carbonyl group. Its solubility in organic solvents and limited solubility in water are typical for ketones, reflecting their hydrophobic nature. The compound's stability can be influenced by factors such as temperature and the presence of other reactive species. Additionally, din-4-one may have applications in organic synthesis, serving as an intermediate in the production of more complex molecules. As with many organic compounds, safety precautions should be taken when handling din-4-one, as it may pose health risks if inhaled or ingested.
Formula:C12H15N3OS
InChI:InChI=1S/C12H15N3OS/c1-7-14-11-10(12(16)15(7)13)8-5-3-2-4-6-9(8)17-11/h2-6,13H2,1H3
InChI key:InChIKey=UXBLDQMSOWQULB-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(SC2N=C(C)N1N)CCCCC3
Synonyms:- 3-Amino-2-Methyl-3,5,6,7,8,9-Hexahydro-4H-Cyclohepta(4,5)Thieno(2,3-D)Pyrimi
- 3-Amino-2-methyl-3,5,6,7,8,9-hexahydro-10-thia-1,3-diaza-benzo[a]azulen-4-one
- 3-Amino-3,5,6,7,8,9-hexahydro-2-methyl-4H-cyclohepta[4,5]thieno[2,3-d]pyrimidin-4-one
- 3-amino-2-methyl-3,5,6,7,8,9-hexahydro-4H-cyclohepta[4,5]thieno[2,3-d]pyrimidin-4-one
- 4H-Cyclohepta(4,5)Thieno(2,3-D)Pyrimidin-4-One,3,5,6,7,8,9-Hexahydro-3-Amino-2
- 4H-Cyclohepta[4,5]thieno[2,3-d]pyrimidin-4-one, 3-amino-3,5,6,7,8,9-hexahydro-2-methyl-
- din-4-one
- 4-Amino-5-methyl-8-thia-4,6-diazatricyclo[7.5.0.0,2,7]tetradeca-1(9),2(7),5-trien-3-one
- 4-amino-5-methyl-8-thia-4,6-diazatricyclo[7.5.0.0²
- 3-aMino-2-Methyl-6,7,8,9-tetrahydro-3H-cyclohepta[4,5]thieno[2,3-d]pyriMidin-4(5H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.