CymitQuimica logo

CAS 1203544-03-9

:

4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-1-propyl-

Description:
4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-1-propyl- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 1,2-dihydro-2-oxo moiety indicates that it has a saturated carbon framework with a carbonyl group, which can influence its reactivity and potential applications in organic synthesis. The propyl substituent suggests that the compound has moderate hydrophobic characteristics, which may affect its solubility in various solvents. Generally, compounds of this nature can exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the molecular structure can lead to various intermolecular interactions, such as hydrogen bonding, which can influence its physical properties, including melting and boiling points. Overall, this compound's unique structure positions it as a potentially valuable substance in both chemical research and application.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c1-2-4-10-5-3-7(9(12)13)6-8(10)11/h3,5-6H,2,4H2,1H3,(H,12,13)
InChI key:InChIKey=YKFNBPZFXVGEEH-UHFFFAOYSA-N
SMILES:C(CC)N1C(=O)C=C(C(O)=O)C=C1
Synonyms:
  • 4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-1-propyl-
  • 2-Oxo-1-propyl-1,2-dihydropyridine-4-carboxylic acid
  • 1,2-Dihydro-2-oxo-1-propyl-4-Pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.