CymitQuimica logo

CAS 1203578-80-6

:

N1-(7-Chloro-1-isoquinolinyl)-1,2-ethanediamine

Description:
N1-(7-Chloro-1-isoquinolinyl)-1,2-ethanediamine is a chemical compound characterized by its unique structure, which includes a chloro-substituted isoquinoline moiety linked to a 1,2-ethanediamine backbone. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential solubility in polar solvents due to the presence of amino groups. The chloro group may influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. The isoquinoline structure suggests possible interactions with biological targets, which could be relevant in medicinal chemistry. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety and handling considerations are essential, as with many chemical substances, particularly those with halogen substituents, which may pose toxicity risks. Overall, N1-(7-Chloro-1-isoquinolinyl)-1,2-ethanediamine represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H12ClN3
InChI:InChI=1S/C11H12ClN3/c12-9-2-1-8-3-5-14-11(10(8)7-9)15-6-4-13/h1-3,5,7H,4,6,13H2,(H,14,15)
InChI key:InChIKey=PYMBHNYPKPHMBG-UHFFFAOYSA-N
SMILES:N(CCN)C=1C2=C(C=CC(Cl)=C2)C=CN1
Synonyms:
  • 1,2-Ethanediamine, N1-(7-chloro-1-isoquinolinyl)-
  • N1-(7-Chloro-1-isoquinolinyl)-1,2-ethanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.