CymitQuimica logo

CAS 1203579-37-6

:

5-Ethynylisoquinoline

Description:
5-Ethynylisoquinoline is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of an ethynyl group at the 5-position of the isoquinoline structure introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a yellow to brown solid and is known for its role in various chemical reactions, including cross-coupling reactions and as a building block in the synthesis of more complex molecules. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, 5-Ethynylisoquinoline may exhibit fluorescence properties, which can be useful in imaging applications. As with many organic compounds, handling should be done with care, considering safety protocols to mitigate any risks associated with its chemical properties.
Formula:C11H7N
InChI:InChI=1S/C11H7N/c1-2-9-4-3-5-10-8-12-7-6-11(9)10/h1,3-8H
InChI key:InChIKey=YBMNMHGMBRLEPL-UHFFFAOYSA-N
SMILES:C(#C)C=1C2=C(C=CC1)C=NC=C2
Synonyms:
  • Isoquinoline, 5-ethynyl-
  • 5-Ethynylisoquinoline
Found 4 products.