CAS 1203579-72-9

Quinoline, 3-chloro-7-methoxy-4-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Quinoline, 3-chloro-7-methoxy-4-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 3-position and a methoxy group at the 7-position contributes to its unique reactivity and potential biological activity. The piperazine moiety at the 4-position enhances its pharmacological properties, making it of interest in medicinal chemistry, particularly for its potential use in treating various conditions. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various biological activities, including antimicrobial or antitumor effects, although specific activities would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₁₆ClN₃O·ClH

InChI: InChI=1S/C14H16ClN3O.ClH/c1-19-10-2-3-11-13(8-10)17-9-12(15)14(11)18-6-4-16-5-7-18;/h2-3,8-9,16H,4-7H2,1H3;1H

InChI key: InChIKey=YQSQGVSAGCUWHN-UHFFFAOYSA-N

SMILES: ClC1=C(C2=C(C=C(OC)C=C2)N=C1)N3CCNCC3.Cl

Synonyms:

• Quinoline, 3-chloro-7-methoxy-4-(1-piperazinyl)-, hydrochloride (1:1)

3-Chloro-7-methoxy-4-(piperazin-1-yl)quinoline Hydrochloride

CAS: 1203579-72-9

3-Chloro-7-methoxy-4-(piperazin-1-yl)quinoline Hydrochloride

Purity: ≥95%

Molecular weight: 314.21g/mol

Ref: 54-OR1075266