CAS 1203605-31-5

1,1-Dimethylethyl N-(thiazolo[4,5-c]pyridin-2-ylmethyl)carbamate

Description:

1,1-Dimethylethyl N-(thiazolo[4,5-c]pyridin-2-ylmethyl)carbamate is a chemical compound characterized by its unique structural features, which include a thiazole and pyridine moiety. This compound is classified as a carbamate, indicating the presence of a carbamate functional group (-NHCOO-), which is known for its applications in pharmaceuticals and agrochemicals. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various bioactive compounds. The dimethyl group attached to the ethyl group suggests steric hindrance, which may influence the compound's reactivity and interaction with biological targets. Additionally, the specific arrangement of atoms and functional groups in this compound may impart unique solubility and stability characteristics, making it of interest for further research in medicinal chemistry. Overall, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways associated with the thiazole and pyridine derivatives.

Formula: C₁₂H₁₅N₃O₂S

InChI: InChI=1S/C12H15N3O2S/c1-12(2,3)17-11(16)14-7-10-15-8-6-13-5-4-9(8)18-10/h4-6H,7H2,1-3H3,(H,14,16)

InChI key: InChIKey=ZGSXCXWZYLTQHE-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1=NC=2C(S1)=CC=NC2

Synonyms:

• 1,1-Dimethylethyl N-(thiazolo[4,5-c]pyridin-2-ylmethyl)carbamate
• Carbamic acid, N-(thiazolo[4,5-c]pyridin-2-ylmethyl)-, 1,1-dimethylethyl ester

tert-Butyl N-({[1,3]thiazolo[4,5-c]pyridin-2-yl}methyl)carbamate

CAS: 1203605-31-5

Versatile small molecule scaffold

Formula: C₁₂H₁₅N₃O₂S

Purity: Min. 95%

Molecular weight: 265.33 g/mol

Ref: 3D-DYB60531