CAS 1203644-34-1
:2-(1-Pyrrolidinylmethyl)benzenethiol
Description:
2-(1-Pyrrolidinylmethyl)benzenethiol is an organic compound characterized by the presence of a thiol group (-SH) attached to a benzene ring, which is further substituted with a pyrrolidine moiety. This compound features a pyrrolidine ring, a five-membered nitrogen-containing heterocycle, linked to a benzyl group, indicating potential for various chemical interactions due to the presence of both the thiol and the nitrogen functionalities. The thiol group contributes to its reactivity, allowing for potential applications in organic synthesis, particularly in the formation of disulfides or as a reducing agent. Additionally, the nitrogen in the pyrrolidine ring can participate in hydrogen bonding and may influence the compound's solubility and reactivity. The compound's structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C11H15NS
InChI:InChI=1S/C11H15NS/c13-11-6-2-1-5-10(11)9-12-7-3-4-8-12/h1-2,5-6,13H,3-4,7-9H2
InChI key:InChIKey=UBMVRJPSVCHMEX-UHFFFAOYSA-N
SMILES:C(C1=C(S)C=CC=C1)N2CCCC2
Synonyms:- Benzenethiol, 2-(1-pyrrolidinylmethyl)-
- 2-(1-Pyrrolidinylmethyl)benzenethiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.