
CAS 1203661-45-3
:1,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-4H-indazol-4-one
Description:
1,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-4H-indazol-4-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing both a five-membered and a six-membered ring. The presence of a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indazole moiety's known bioactivity. The trifluoromethyl group can also contribute to the compound's stability and reactivity, making it a subject of interest in various chemical reactions. As with many indazole derivatives, it may exhibit a range of biological activities, including anti-inflammatory or anticancer properties, although specific biological data would need to be referenced for detailed insights. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H11F3N2O
InChI:InChI=1S/C14H11F3N2O/c15-14(16,17)9-3-1-4-10(7-9)19-12-5-2-6-13(20)11(12)8-18-19/h1,3-4,7-8H,2,5-6H2
InChI key:InChIKey=AJBZIJUVDWSCPH-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(N=C2)C3=CC(C(F)(F)F)=CC=C3)CCC1
Synonyms:- 4H-Indazol-4-one, 1,5,6,7-tetrahydro-1-[3-(trifluoromethyl)phenyl]-
- 1,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-4H-indazol-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.